C15H19N3O5S — CID 51146157
4-(cyclopropylamino)-N-(3-methyl-1,1-dioxothiolan-3-yl)-3-nitrobenzamide (PubChem CID 51146157) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-(3-methyl-1,1-dioxothiolan-3-yl)-3-nitrobenzamide.
| Compound Name | 4-(cyclopropylamino)-N-(3-methyl-1,1-dioxothiolan-3-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 51146157 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 4-(cyclopropylamino)-N-(3-methyl-1,1-dioxothiolan-3-yl)-3-nitrobenzamide |
| SMILES | CC1(NC(=O)c2ccc(NC3CC3)c([N+](=O)[O-])c2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19N3O5S/c1-15(6-7-24(22,23)9-15)17-14(19)10-2-5-12(16-11-3-4-11)13(8-10)18(20)21/h2,5,8,11,16H,3-4,6-7,9H2,1H3,(H,17,19) |
| InChIKey | XHXPEMONUJIPQD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|