C16H13Cl2N3O3 — CID 55335047
4-(cyclopropylamino)-N-(2,5-dichlorophenyl)-3-nitrobenzamide (PubChem CID 55335047) has the molecular formula C16H13Cl2N3O3 and a molecular weight of 366.20 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-(2,5-dichlorophenyl)-3-nitrobenzamide.
| Compound Name | 4-(cyclopropylamino)-N-(2,5-dichlorophenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 55335047 |
| Molecular Formula | C16H13Cl2N3O3 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 4-(cyclopropylamino)-N-(2,5-dichlorophenyl)-3-nitrobenzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13Cl2N3O3/c17-10-2-5-12(18)14(8-10)20-16(22)9-1-6-13(19-11-3-4-11)15(7-9)21(23)24/h1-2,5-8,11,19H,3-4H2,(H,20,22) |
| InChIKey | OOGUCYSXODNAIV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|