C20H22ClN3O4 — CID 24533644
N-[4-(4-chlorophenoxy)butyl]-4-(cyclopropylamino)-3-nitrobenzamide (PubChem CID 24533644) has the molecular formula C20H22ClN3O4 and a molecular weight of 403.87 g/mol. Its IUPAC name is N-[4-(4-chlorophenoxy)butyl]-4-(cyclopropylamino)-3-nitrobenzamide.
| Compound Name | N-[4-(4-chlorophenoxy)butyl]-4-(cyclopropylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 24533644 |
| Molecular Formula | C20H22ClN3O4 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-[4-(4-chlorophenoxy)butyl]-4-(cyclopropylamino)-3-nitrobenzamide |
| SMILES | O=C(NCCCCOc1ccc(Cl)cc1)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H22ClN3O4/c21-15-4-8-17(9-5-15)28-12-2-1-11-22-20(25)14-3-10-18(23-16-6-7-16)19(13-14)24(26)27/h3-5,8-10,13,16,23H,1-2,6-7,11-12H2,(H,22,25) |
| InChIKey | XWTOVPWHENYNAG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|