C22H19ClN4O5S — CID 26186662
N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(cyclopropylamino)-3-nitrobenzamide (PubChem CID 26186662) has the molecular formula C22H19ClN4O5S and a molecular weight of 486.94 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(cyclopropylamino)-3-nitrobenzamide.
| Compound Name | N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(cyclopropylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 26186662 |
| Molecular Formula | C22H19ClN4O5S |
| Molecular Weight | 486.94 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(cyclopropylamino)-3-nitrobenzamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccc(Cl)cc2)C1=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H19ClN4O5S/c23-15-4-1-13(2-5-15)11-19-21(29)26(22(30)33-19)10-9-24-20(28)14-3-8-17(25-16-6-7-16)18(12-14)27(31)32/h1-5,8,11-12,16,25H,6-7,9-10H2,(H,24,28)/b19-11- |
| InChIKey | TVJULNJDMBLJLE-ODLFYWEKSA-N |
| XLogP | 4.29 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.94 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|