C19H16N4O5S — CID 27614804
4-amino-N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-nitrobenzamide (PubChem CID 27614804) has the molecular formula C19H16N4O5S and a molecular weight of 412.43 g/mol. Its IUPAC name is 4-amino-N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-nitrobenzamide.
| Compound Name | 4-amino-N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 27614804 |
| Molecular Formula | C19H16N4O5S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 4-amino-N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-nitrobenzamide |
| SMILES | Nc1ccc(C(=O)NCCN2C(=O)S/C(=C\c3ccccc3)C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16N4O5S/c20-14-7-6-13(11-15(14)23(27)28)17(24)21-8-9-22-18(25)16(29-19(22)26)10-12-4-2-1-3-5-12/h1-7,10-11H,8-9,20H2,(H,21,24)/b16-10- |
| InChIKey | FHLMCMUQQYCVQF-YBEGLDIGSA-N |
| XLogP | 2.64 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|