C22H21N3O8S — CID 6091920
N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-nitrobenzamide (PubChem CID 6091920) has the molecular formula C22H21N3O8S and a molecular weight of 487.49 g/mol. Its IUPAC name is N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-nitrobenzamide.
| Compound Name | N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 6091920 |
| Molecular Formula | C22H21N3O8S |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-2-nitrobenzamide |
| SMILES | COc1cc(/C=C2\SC(=O)N(CCNC(=O)c3ccccc3[N+](=O)[O-])C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C22H21N3O8S/c1-31-16-10-13(11-17(32-2)19(16)33-3)12-18-21(27)24(22(28)34-18)9-8-23-20(26)14-6-4-5-7-15(14)25(29)30/h4-7,10-12H,8-9H2,1-3H3,(H,23,26)/b18-12- |
| InChIKey | FIHNFWRGGVRQIG-PDGQHHTCSA-N |
| XLogP | 3.09 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|