C24H22N2O6S2 — CID 24680505
N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 24680505) has the molecular formula C24H22N2O6S2 and a molecular weight of 498.58 g/mol. Its IUPAC name is N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 24680505 |
| Molecular Formula | C24H22N2O6S2 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | COc1cc(/C=C2\SC(=O)N(CCNC(=O)c3cc4ccccc4s3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C24H22N2O6S2/c1-30-16-10-14(11-17(31-2)21(16)32-3)12-20-23(28)26(24(29)34-20)9-8-25-22(27)19-13-15-6-4-5-7-18(15)33-19/h4-7,10-13H,8-9H2,1-3H3,(H,25,27)/b20-12- |
| InChIKey | YYDYNWBBTSMHDG-NDENLUEZSA-N |
| XLogP | 4.39 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|