C21H22N2O6S2 — CID 6214237
N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-5-methylthiophene-2-carboxamide (PubChem CID 6214237) has the molecular formula C21H22N2O6S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 6214237 |
| Molecular Formula | C21H22N2O6S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | N-[2-[(5Z)-2,4-dioxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]ethyl]-5-methylthiophene-2-carboxamide |
| SMILES | COc1cc(/C=C2\SC(=O)N(CCNC(=O)c3ccc(C)s3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H22N2O6S2/c1-12-5-6-16(30-12)19(24)22-7-8-23-20(25)17(31-21(23)26)11-13-9-14(27-2)18(29-4)15(10-13)28-3/h5-6,9-11H,7-8H2,1-4H3,(H,22,24)/b17-11- |
| InChIKey | NQXIQQSJXBXNED-BOPFTXTBSA-N |
| XLogP | 3.55 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|