C17H21NO6S — CID 4215469
3-(3-methoxypropyl)-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 4215469) has the molecular formula C17H21NO6S and a molecular weight of 367.42 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-(3-methoxypropyl)-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4215469 |
| Molecular Formula | C17H21NO6S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 3-(3-methoxypropyl)-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COCCCN1C(=O)SC(=Cc2cc(OC)c(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C17H21NO6S/c1-21-7-5-6-18-16(19)14(25-17(18)20)10-11-8-12(22-2)15(24-4)13(9-11)23-3/h8-10H,5-7H2,1-4H3 |
| InChIKey | LOMKCPJLIQQAMG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|