C16H18ClNO5S — CID 126260610
(5E)-5-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126260610) has the molecular formula C16H18ClNO5S and a molecular weight of 371.84 g/mol. Its IUPAC name is (5E)-5-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126260610 |
| Molecular Formula | C16H18ClNO5S |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (5E)-5-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CCCOC)C2=O)cc(Cl)c1O |
| InChI | InChI=1S/C16H18ClNO5S/c1-3-23-12-8-10(7-11(17)14(12)19)9-13-15(20)18(16(21)24-13)5-4-6-22-2/h7-9,19H,3-6H2,1-2H3/b13-9+ |
| InChIKey | XEINCWMYFAPALR-UKTHLTGXSA-N |
| XLogP | 3.52 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|