C14H15NO6S — CID 1240601
(5Z)-3-(hydroxymethyl)-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 1240601) has the molecular formula C14H15NO6S and a molecular weight of 325.34 g/mol. Its IUPAC name is (5Z)-3-(hydroxymethyl)-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(hydroxymethyl)-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1240601 |
| Molecular Formula | C14H15NO6S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | (5Z)-3-(hydroxymethyl)-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2\SC(=O)N(CO)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C14H15NO6S/c1-19-9-4-8(5-10(20-2)12(9)21-3)6-11-13(17)15(7-16)14(18)22-11/h4-6,16H,7H2,1-3H3/b11-6- |
| InChIKey | AXYXJANHKRCMPV-WDZFZDKYSA-N |
| XLogP | 1.70 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|