C13H13NO5S — CID 75538988
(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-3-(hydroxymethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 75538988) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is (5E)-5-[(3,4-dimethoxyphenyl)methylidene]-3-(hydroxymethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3,4-dimethoxyphenyl)methylidene]-3-(hydroxymethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 75538988 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | (5E)-5-[(3,4-dimethoxyphenyl)methylidene]-3-(hydroxymethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(/C=C2/SC(=O)N(CO)C2=O)cc1OC |
| InChI | InChI=1S/C13H13NO5S/c1-18-9-4-3-8(5-10(9)19-2)6-11-12(16)14(7-15)13(17)20-11/h3-6,15H,7H2,1-2H3/b11-6+ |
| InChIKey | HUVYVTZDRXUZPD-IZZDOVSWSA-N |
| XLogP | 1.69 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|