C21H17NO7S — CID 5088059
(2-formylphenyl) 2-[5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 5088059) has the molecular formula C21H17NO7S and a molecular weight of 427.43 g/mol. Its IUPAC name is (2-formylphenyl) 2-[5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | (2-formylphenyl) 2-[5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 5088059 |
| Molecular Formula | C21H17NO7S |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | (2-formylphenyl) 2-[5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COc1ccc(C=C2SC(=O)N(CC(=O)Oc3ccccc3C=O)C2=O)cc1OC |
| InChI | InChI=1S/C21H17NO7S/c1-27-16-8-7-13(9-17(16)28-2)10-18-20(25)22(21(26)30-18)11-19(24)29-15-6-4-3-5-14(15)12-23/h3-10,12H,11H2,1-2H3 |
| InChIKey | WVBNVWNKBZWOSZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|