C16H17NO6S — CID 126318722
[2-methoxy-4-[(Z)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] acetate (PubChem CID 126318722) has the molecular formula C16H17NO6S and a molecular weight of 351.38 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[(Z)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 126318722 |
| Molecular Formula | C16H17NO6S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | [2-methoxy-4-[(Z)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] acetate |
| SMILES | COCCN1C(=O)S/C(=C\c2ccc(OC(C)=O)c(OC)c2)C1=O |
| InChI | InChI=1S/C16H17NO6S/c1-10(18)23-12-5-4-11(8-13(12)22-3)9-14-15(19)17(6-7-21-2)16(20)24-14/h4-5,8-9H,6-7H2,1-3H3/b14-9- |
| InChIKey | MGLKPMJJCWPOEA-ZROIWOOFSA-N |
| XLogP | 2.30 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|