C25H29NO6S — CID 126219921
[2-methoxy-4-[(Z)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] adamantane-1-carboxylate (PubChem CID 126219921) has the molecular formula C25H29NO6S and a molecular weight of 471.58 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] adamantane-1-carboxylate.
| Compound Name | [2-methoxy-4-[(Z)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 126219921 |
| Molecular Formula | C25H29NO6S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | [2-methoxy-4-[(Z)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] adamantane-1-carboxylate |
| SMILES | COCCN1C(=O)S/C(=C\c2ccc(OC(=O)C34CC5CC(CC(C5)C3)C4)c(OC)c2)C1=O |
| InChI | InChI=1S/C25H29NO6S/c1-30-6-5-26-22(27)21(33-24(26)29)11-15-3-4-19(20(10-15)31-2)32-23(28)25-12-16-7-17(13-25)9-18(8-16)14-25/h3-4,10-11,16-18H,5-9,12-14H2,1-2H3/b21-11- |
| InChIKey | VMTMIQQGVQPNRL-NHDPSOOVSA-N |
| XLogP | 4.50 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|