C29H29NO5S2 — CID 6241395
[2-methoxy-4-[(E)-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] adamantane-1-carboxylate (PubChem CID 6241395) has the molecular formula C29H29NO5S2 and a molecular weight of 535.69 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] adamantane-1-carboxylate.
| Compound Name | [2-methoxy-4-[(E)-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 6241395 |
| Molecular Formula | C29H29NO5S2 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | [2-methoxy-4-[(E)-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] adamantane-1-carboxylate |
| SMILES | COc1ccc(N2C(=O)/C(=C\c3ccc(OC(=O)C45CC6CC(CC(C6)C4)C5)c(OC)c3)SC2=S)cc1 |
| InChI | InChI=1S/C29H29NO5S2/c1-33-22-6-4-21(5-7-22)30-26(31)25(37-28(30)36)13-17-3-8-23(24(12-17)34-2)35-27(32)29-14-18-9-19(15-29)11-20(10-18)16-29/h3-8,12-13,18-20H,9-11,14-16H2,1-2H3/b25-13+ |
| InChIKey | RFDALPUPDXEILQ-DHRITJCHSA-N |
| XLogP | 6.23 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|