C29H28BrNO5S — CID 126159253
[4-[(Z)-[3-[(3-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] adamantane-1-carboxylate (PubChem CID 126159253) has the molecular formula C29H28BrNO5S and a molecular weight of 582.52 g/mol. Its IUPAC name is [4-[(Z)-[3-[(3-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] adamantane-1-carboxylate.
| Compound Name | [4-[(Z)-[3-[(3-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 126159253 |
| Molecular Formula | C29H28BrNO5S |
| Molecular Weight | 582.52 g/mol |
| Exact Mass | 581.09 |
| IUPAC Name | [4-[(Z)-[3-[(3-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] adamantane-1-carboxylate |
| SMILES | COc1cc(/C=C2\SC(=O)N(Cc3cccc(Br)c3)C2=O)ccc1OC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C29H28BrNO5S/c1-35-24-11-17(12-25-26(32)31(28(34)37-25)16-18-3-2-4-22(30)10-18)5-6-23(24)36-27(33)29-13-19-7-20(14-29)9-21(8-19)15-29/h2-6,10-12,19-21H,7-9,13-16H2,1H3/b25-12- |
| InChIKey | KLTHMSCEOPGISU-ROTLSHHCSA-N |
| XLogP | 6.82 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.52 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|