C19H14BrF2NO4S — CID 126366750
(5Z)-3-[(3-bromophenyl)methyl]-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126366750) has the molecular formula C19H14BrF2NO4S and a molecular weight of 470.29 g/mol. Its IUPAC name is (5Z)-3-[(3-bromophenyl)methyl]-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(3-bromophenyl)methyl]-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126366750 |
| Molecular Formula | C19H14BrF2NO4S |
| Molecular Weight | 470.29 g/mol |
| Exact Mass | 468.98 |
| IUPAC Name | (5Z)-3-[(3-bromophenyl)methyl]-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2\SC(=O)N(Cc3cccc(Br)c3)C2=O)ccc1OC(F)F |
| InChI | InChI=1S/C19H14BrF2NO4S/c1-26-15-8-11(5-6-14(15)27-18(21)22)9-16-17(24)23(19(25)28-16)10-12-3-2-4-13(20)7-12/h2-9,18H,10H2,1H3/b16-9- |
| InChIKey | RLURBUKWBOLELU-SXGWCWSVSA-N |
| XLogP | 5.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.29 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|