C24H25BrN2O6S — CID 126200202
N-(2-bromo-4,5-dimethylphenyl)-2-[2-methoxy-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126200202) has the molecular formula C24H25BrN2O6S and a molecular weight of 549.44 g/mol. Its IUPAC name is N-(2-bromo-4,5-dimethylphenyl)-2-[2-methoxy-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(2-bromo-4,5-dimethylphenyl)-2-[2-methoxy-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126200202 |
| Molecular Formula | C24H25BrN2O6S |
| Molecular Weight | 549.44 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | N-(2-bromo-4,5-dimethylphenyl)-2-[2-methoxy-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | COCCN1C(=O)S/C(=C/c2ccc(OCC(=O)Nc3cc(C)c(C)cc3Br)c(OC)c2)C1=O |
| InChI | InChI=1S/C24H25BrN2O6S/c1-14-9-17(25)18(10-15(14)2)26-22(28)13-33-19-6-5-16(11-20(19)32-4)12-21-23(29)27(7-8-31-3)24(30)34-21/h5-6,9-12H,7-8,13H2,1-4H3,(H,26,28)/b21-12+ |
| InChIKey | JJBFHIPZMKTDHS-CIAFOILYSA-N |
| XLogP | 4.77 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|