C29H25BrN2O6S — CID 126231285
N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(E)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetamide (PubChem CID 126231285) has the molecular formula C29H25BrN2O6S and a molecular weight of 609.50 g/mol. Its IUPAC name is N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(E)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(E)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126231285 |
| Molecular Formula | C29H25BrN2O6S |
| Molecular Weight | 609.50 g/mol |
| Exact Mass | 608.06 |
| IUPAC Name | N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(E)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)c3ccccc3)C2=O)ccc1OCC(=O)Nc1cc(C)c(C)cc1Br |
| InChI | InChI=1S/C29H25BrN2O6S/c1-17-11-21(30)22(12-18(17)2)31-27(34)16-38-24-10-9-19(13-25(24)37-3)14-26-28(35)32(29(36)39-26)15-23(33)20-7-5-4-6-8-20/h4-14H,15-16H2,1-3H3,(H,31,34)/b26-14+ |
| InChIKey | ONSLOZSQOOAWNI-VULFUBBASA-N |
| XLogP | 6.01 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|