C29H26N2O6S — CID 126224008
N-(3,4-dimethylphenyl)-2-[4-[(E)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetamide (PubChem CID 126224008) has the molecular formula C29H26N2O6S and a molecular weight of 530.60 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[4-[(E)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[4-[(E)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126224008 |
| Molecular Formula | C29H26N2O6S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[4-[(E)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)c3ccccc3)C2=O)ccc1OCC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C29H26N2O6S/c1-18-9-11-22(13-19(18)2)30-27(33)17-37-24-12-10-20(14-25(24)36-3)15-26-28(34)31(29(35)38-26)16-23(32)21-7-5-4-6-8-21/h4-15H,16-17H2,1-3H3,(H,30,33)/b26-15+ |
| InChIKey | BVGHPEBAUPEZHM-CVKSISIWSA-N |
| XLogP | 5.25 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|