C27H29BrN2O7S — CID 126208309
butyl 2-[(5E)-5-[[4-[2-(2-bromo-4,5-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126208309) has the molecular formula C27H29BrN2O7S and a molecular weight of 605.51 g/mol. Its IUPAC name is butyl 2-[(5E)-5-[[4-[2-(2-bromo-4,5-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | butyl 2-[(5E)-5-[[4-[2-(2-bromo-4,5-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126208309 |
| Molecular Formula | C27H29BrN2O7S |
| Molecular Weight | 605.51 g/mol |
| Exact Mass | 604.09 |
| IUPAC Name | butyl 2-[(5E)-5-[[4-[2-(2-bromo-4,5-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCCCOC(=O)CN1C(=O)S/C(=C/c2ccc(OCC(=O)Nc3cc(C)c(C)cc3Br)c(OC)c2)C1=O |
| InChI | InChI=1S/C27H29BrN2O7S/c1-5-6-9-36-25(32)14-30-26(33)23(38-27(30)34)13-18-7-8-21(22(12-18)35-4)37-15-24(31)29-20-11-17(3)16(2)10-19(20)28/h7-8,10-13H,5-6,9,14-15H2,1-4H3,(H,29,31)/b23-13+ |
| InChIKey | ZIWDGUAQOOKYES-YDZHTSKRSA-N |
| XLogP | 5.47 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|