C20H25NO6S — CID 126206672
butyl 2-[(5Z)-5-[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126206672) has the molecular formula C20H25NO6S and a molecular weight of 407.49 g/mol. Its IUPAC name is butyl 2-[(5Z)-5-[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | butyl 2-[(5Z)-5-[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126206672 |
| Molecular Formula | C20H25NO6S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | butyl 2-[(5Z)-5-[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCCCOC(=O)CN1C(=O)S/C(=C\c2ccc(OC(C)C)c(OC)c2)C1=O |
| InChI | InChI=1S/C20H25NO6S/c1-5-6-9-26-18(22)12-21-19(23)17(28-20(21)24)11-14-7-8-15(27-13(2)3)16(10-14)25-4/h7-8,10-11,13H,5-6,9,12H2,1-4H3/b17-11- |
| InChIKey | IIMYBGXEGNTVQT-BOPFTXTBSA-N |
| XLogP | 3.86 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|