C16H14N2O3S3 — CID 2386333
N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-5-methylthiophene-2-carboxamide (PubChem CID 2386333) has the molecular formula C16H14N2O3S3 and a molecular weight of 378.50 g/mol. Its IUPAC name is N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 2386333 |
| Molecular Formula | C16H14N2O3S3 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCN2C(=O)S/C(=C\c3cccs3)C2=O)s1 |
| InChI | InChI=1S/C16H14N2O3S3/c1-10-4-5-12(23-10)14(19)17-6-7-18-15(20)13(24-16(18)21)9-11-3-2-8-22-11/h2-5,8-9H,6-7H2,1H3,(H,17,19)/b13-9- |
| InChIKey | GXMYZBDMQANPJO-LCYFTJDESA-N |
| XLogP | 3.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|