C19H15N3O7S2 — CID 2378625
methyl 3-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethylcarbamoyl]-5-nitrobenzoate (PubChem CID 2378625) has the molecular formula C19H15N3O7S2 and a molecular weight of 461.48 g/mol. Its IUPAC name is methyl 3-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethylcarbamoyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethylcarbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 2378625 |
| Molecular Formula | C19H15N3O7S2 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | methyl 3-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethylcarbamoyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)NCCN2C(=O)S/C(=C\c3cccs3)C2=O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H15N3O7S2/c1-29-18(25)12-7-11(8-13(9-12)22(27)28)16(23)20-4-5-21-17(24)15(31-19(21)26)10-14-3-2-6-30-14/h2-3,6-10H,4-5H2,1H3,(H,20,23)/b15-10- |
| InChIKey | NBYUFYAOAOOUGD-GDNBJRDFSA-N |
| XLogP | 2.91 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|