C24H23N3O5S2 — CID 2409389
N-[2-[(5E)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 2409389) has the molecular formula C24H23N3O5S2 and a molecular weight of 497.60 g/mol. Its IUPAC name is N-[2-[(5E)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[2-[(5E)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 2409389 |
| Molecular Formula | C24H23N3O5S2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | N-[2-[(5E)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CC(C)CCN1C(=O)c2ccc(C(=O)NCCN3C(=O)S/C(=C/c4cccs4)C3=O)cc2C1=O |
| InChI | InChI=1S/C24H23N3O5S2/c1-14(2)7-9-26-21(29)17-6-5-15(12-18(17)22(26)30)20(28)25-8-10-27-23(31)19(34-24(27)32)13-16-4-3-11-33-16/h3-6,11-14H,7-10H2,1-2H3,(H,25,28)/b19-13+ |
| InChIKey | VHILDMNTJSBHDN-CPNJWEJPSA-N |
| XLogP | 3.86 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|