C28H20FN3O5S — CID 4839182
3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide (PubChem CID 4839182) has the molecular formula C28H20FN3O5S and a molecular weight of 529.55 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide.
| Compound Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 4839182 |
| Molecular Formula | C28H20FN3O5S |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
| SMILES | O=C(NCCN1C(=O)SC(=Cc2ccccc2F)C1=O)c1cccc(CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C28H20FN3O5S/c29-22-11-4-1-7-18(22)15-23-27(36)31(28(37)38-23)13-12-30-24(33)19-8-5-6-17(14-19)16-32-25(34)20-9-2-3-10-21(20)26(32)35/h1-11,14-15H,12-13,16H2,(H,30,33) |
| InChIKey | OMJXPQMDYPQNJJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|