C20H12F6N2O3S — CID 24555118
N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 24555118) has the molecular formula C20H12F6N2O3S and a molecular weight of 474.38 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 24555118 |
| Molecular Formula | C20H12F6N2O3S |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | O=C(Cc1c(F)c(F)c(F)c(F)c1F)NCCN1C(=O)S/C(=C\c2ccccc2F)C1=O |
| InChI | InChI=1S/C20H12F6N2O3S/c21-11-4-2-1-3-9(11)7-12-19(30)28(20(31)32-12)6-5-27-13(29)8-10-14(22)16(24)18(26)17(25)15(10)23/h1-4,7H,5-6,8H2,(H,27,29)/b12-7- |
| InChIKey | MHPSWPWGAAOVAY-GHXNOFRVSA-N |
| XLogP | 3.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|