C19H13F3N2O3S — CID 78567983
2,4-difluoro-N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide (PubChem CID 78567983) has the molecular formula C19H13F3N2O3S and a molecular weight of 406.39 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide.
| Compound Name | 2,4-difluoro-N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 78567983 |
| Molecular Formula | C19H13F3N2O3S |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 2,4-difluoro-N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
| SMILES | O=C(NCCN1C(=O)SC(=Cc2ccccc2F)C1=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H13F3N2O3S/c20-12-5-6-13(15(22)10-12)17(25)23-7-8-24-18(26)16(28-19(24)27)9-11-3-1-2-4-14(11)21/h1-6,9-10H,7-8H2,(H,23,25) |
| InChIKey | CHMZQITVXPAUPU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|