C22H16FN3O3S — CID 24564291
N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]quinoline-8-carboxamide (PubChem CID 24564291) has the molecular formula C22H16FN3O3S and a molecular weight of 421.45 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]quinoline-8-carboxamide.
| Compound Name | N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 24564291 |
| Molecular Formula | C22H16FN3O3S |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]quinoline-8-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccccc2F)C1=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C22H16FN3O3S/c23-17-9-2-1-5-15(17)13-18-21(28)26(22(29)30-18)12-11-25-20(27)16-8-3-6-14-7-4-10-24-19(14)16/h1-10,13H,11-12H2,(H,25,27)/b18-13- |
| InChIKey | ULUPXTHYWJYELT-AQTBWJFISA-N |
| XLogP | 3.84 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|