C26H20FN3O4S — CID 24658559
4-benzamido-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide (PubChem CID 24658559) has the molecular formula C26H20FN3O4S and a molecular weight of 489.53 g/mol. Its IUPAC name is 4-benzamido-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide.
| Compound Name | 4-benzamido-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 24658559 |
| Molecular Formula | C26H20FN3O4S |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 4-benzamido-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]benzamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccccc2F)C1=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H20FN3O4S/c27-21-9-5-4-8-19(21)16-22-25(33)30(26(34)35-22)15-14-28-23(31)18-10-12-20(13-11-18)29-24(32)17-6-2-1-3-7-17/h1-13,16H,14-15H2,(H,28,31)(H,29,32)/b22-16- |
| InChIKey | JPSHGRWPMLSWMY-JWGURIENSA-N |
| XLogP | 4.54 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|