C18H14FN3O4S — CID 24564282
N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 24564282) has the molecular formula C18H14FN3O4S and a molecular weight of 387.39 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24564282 |
| Molecular Formula | C18H14FN3O4S |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccccc2F)C1=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C18H14FN3O4S/c19-13-4-2-1-3-11(13)9-14-17(25)22(18(26)27-14)8-7-20-16(24)12-5-6-15(23)21-10-12/h1-6,9-10H,7-8H2,(H,20,24)(H,21,23)/b14-9- |
| InChIKey | NBWKECFTNPDOEE-ZROIWOOFSA-N |
| XLogP | 1.98 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|