C20H14FN5O5S — CID 55734285
N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 55734285) has the molecular formula C20H14FN5O5S and a molecular weight of 455.43 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 55734285 |
| Molecular Formula | C20H14FN5O5S |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccccc2F)C1=O)c1cnc2[nH]c(=O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C20H14FN5O5S/c21-13-4-2-1-3-10(13)8-14-18(29)26(20(31)32-14)6-5-22-16(27)11-7-12-15(23-9-11)24-19(30)25-17(12)28/h1-4,7-9H,5-6H2,(H,22,27)(H2,23,24,25,28,30)/b14-8- |
| InChIKey | LBXSJDHZDSRGRX-ZSOIEALJSA-N |
| XLogP | 1.22 |
| TPSA | 145.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|