C20H14F2N2O5S — CID 26211044
N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,4-difluorobenzamide (PubChem CID 26211044) has the molecular formula C20H14F2N2O5S and a molecular weight of 432.40 g/mol. Its IUPAC name is N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 26211044 |
| Molecular Formula | C20H14F2N2O5S |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2,4-difluorobenzamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccc3c(c2)OCO3)C1=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H14F2N2O5S/c21-12-2-3-13(14(22)9-12)18(25)23-5-6-24-19(26)17(30-20(24)27)8-11-1-4-15-16(7-11)29-10-28-15/h1-4,7-9H,5-6,10H2,(H,23,25)/b17-8- |
| InChIKey | RAHONNJIFJTGBS-IUXPMGMMSA-N |
| XLogP | 3.16 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|