C22H20N4O7S — CID 26210959
N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(dimethylamino)-5-nitrobenzamide (PubChem CID 26210959) has the molecular formula C22H20N4O7S and a molecular weight of 484.49 g/mol. Its IUPAC name is N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(dimethylamino)-5-nitrobenzamide.
| Compound Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(dimethylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 26210959 |
| Molecular Formula | C22H20N4O7S |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(dimethylamino)-5-nitrobenzamide |
| SMILES | CN(C)c1ccc([N+](=O)[O-])cc1C(=O)NCCN1C(=O)S/C(=C\c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C22H20N4O7S/c1-24(2)16-5-4-14(26(30)31)11-15(16)20(27)23-7-8-25-21(28)19(34-22(25)29)10-13-3-6-17-18(9-13)33-12-32-17/h3-6,9-11H,7-8,12H2,1-2H3,(H,23,27)/b19-10- |
| InChIKey | JMLTWPMHUGGGEN-GRSHGNNSSA-N |
| XLogP | 2.86 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|