C23H27N3O5S3 — CID 25362274
(2S)-N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide (PubChem CID 25362274) has the molecular formula C23H27N3O5S3 and a molecular weight of 521.69 g/mol. Its IUPAC name is (2S)-N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide.
| Compound Name | (2S)-N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 25362274 |
| Molecular Formula | C23H27N3O5S3 |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | (2S)-N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CC(C)C)C(=O)NCCN2C(=O)S/C(=C\c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C23H27N3O5S3/c1-15(2)13-19(25-34(30,31)18-8-6-16(3)7-9-18)21(27)24-10-11-26-22(28)20(33-23(26)29)14-17-5-4-12-32-17/h4-9,12,14-15,19,25H,10-11,13H2,1-3H3,(H,24,27)/b20-14-/t19-/m0/s1 |
| InChIKey | HCCPBZXCBZYQFJ-QIYXJHPLSA-N |
| XLogP | 3.60 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|