C20H28N4O3S3 — CID 42934845
1-[[4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]amino]-3-(2-thiophen-2-ylethyl)thiourea (PubChem CID 42934845) has the molecular formula C20H28N4O3S3 and a molecular weight of 468.67 g/mol. Its IUPAC name is 1-[[4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]amino]-3-(2-thiophen-2-ylethyl)thiourea.
| Compound Name | 1-[[4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]amino]-3-(2-thiophen-2-ylethyl)thiourea |
|---|---|
| PubChem CID | 42934845 |
| Molecular Formula | C20H28N4O3S3 |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 1-[[4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]amino]-3-(2-thiophen-2-ylethyl)thiourea |
| SMILES | Cc1ccc(S(=O)(=O)NC(CC(C)C)C(=O)NNC(=S)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C20H28N4O3S3/c1-14(2)13-18(24-30(26,27)17-8-6-15(3)7-9-17)19(25)22-23-20(28)21-11-10-16-5-4-12-29-16/h4-9,12,14,18,24H,10-11,13H2,1-3H3,(H,22,25)(H2,21,23,28) |
| InChIKey | YGTISFWTPPCWFM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|