C22H22FN3O5S2 — CID 55936728
(2S)-2-[(2-fluorophenyl)sulfonylamino]-N-[2-[(5E)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]propanamide (PubChem CID 55936728) has the molecular formula C22H22FN3O5S2 and a molecular weight of 491.57 g/mol. Its IUPAC name is (2S)-2-[(2-fluorophenyl)sulfonylamino]-N-[2-[(5E)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]propanamide.
| Compound Name | (2S)-2-[(2-fluorophenyl)sulfonylamino]-N-[2-[(5E)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 55936728 |
| Molecular Formula | C22H22FN3O5S2 |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | (2S)-2-[(2-fluorophenyl)sulfonylamino]-N-[2-[(5E)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]propanamide |
| SMILES | Cc1ccc(/C=C2/SC(=O)N(CCNC(=O)[C@H](C)NS(=O)(=O)c3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C22H22FN3O5S2/c1-14-7-9-16(10-8-14)13-18-21(28)26(22(29)32-18)12-11-24-20(27)15(2)25-33(30,31)19-6-4-3-5-17(19)23/h3-10,13,15,25H,11-12H2,1-2H3,(H,24,27)/b18-13+/t15-/m0/s1 |
| InChIKey | KFCRIDJYTVPHKT-VUODPORTSA-N |
| XLogP | 2.65 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|