C21H20N2O5S2 — CID 2671427
N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylsulfonylbenzamide (PubChem CID 2671427) has the molecular formula C21H20N2O5S2 and a molecular weight of 444.53 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 2671427 |
| Molecular Formula | C21H20N2O5S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | N-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylsulfonylbenzamide |
| SMILES | Cc1ccc(/C=C2\SC(=O)N(CCNC(=O)c3ccc(S(C)(=O)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H20N2O5S2/c1-14-3-5-15(6-4-14)13-18-20(25)23(21(26)29-18)12-11-22-19(24)16-7-9-17(10-8-16)30(2,27)28/h3-10,13H,11-12H2,1-2H3,(H,22,24)/b18-13- |
| InChIKey | MSJXYZASJJLKMC-AQTBWJFISA-N |
| XLogP | 2.86 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|