C24H26N4O4S — CID 55909455
N-[2-[5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(propan-2-ylcarbamoylamino)benzamide (PubChem CID 55909455) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is N-[2-[5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(propan-2-ylcarbamoylamino)benzamide.
| Compound Name | N-[2-[5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(propan-2-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 55909455 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N-[2-[5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-(propan-2-ylcarbamoylamino)benzamide |
| SMILES | Cc1ccc(C=C2SC(=O)N(CCNC(=O)c3ccc(NC(=O)NC(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H26N4O4S/c1-15(2)26-23(31)27-19-10-8-18(9-11-19)21(29)25-12-13-28-22(30)20(33-24(28)32)14-17-6-4-16(3)5-7-17/h4-11,14-15H,12-13H2,1-3H3,(H,25,29)(H2,26,27,31) |
| InChIKey | CWIBKBOILRJNKD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|