C26H22N4O4S — CID 55630381
N-[3-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]phenyl]pyridine-3-carboxamide (PubChem CID 55630381) has the molecular formula C26H22N4O4S and a molecular weight of 486.55 g/mol. Its IUPAC name is N-[3-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55630381 |
| Molecular Formula | C26H22N4O4S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | N-[3-[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]phenyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(/C=C2\SC(=O)N(CCNC(=O)c3cccc(NC(=O)c4cccnc4)c3)C2=O)cc1 |
| InChI | InChI=1S/C26H22N4O4S/c1-17-7-9-18(10-8-17)14-22-25(33)30(26(34)35-22)13-12-28-23(31)19-4-2-6-21(15-19)29-24(32)20-5-3-11-27-16-20/h2-11,14-16H,12-13H2,1H3,(H,28,31)(H,29,32)/b22-14- |
| InChIKey | KNWXECFNCOEPJX-HMAPJEAMSA-N |
| XLogP | 4.11 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|