C24H19N3O4S2 — CID 27845138
N-[3-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 27845138) has the molecular formula C24H19N3O4S2 and a molecular weight of 477.57 g/mol. Its IUPAC name is N-[3-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 27845138 |
| Molecular Formula | C24H19N3O4S2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | N-[3-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethylcarbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccccc2)C1=O)c1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C24H19N3O4S2/c28-21(17-8-4-9-18(15-17)26-22(29)19-10-5-13-32-19)25-11-12-27-23(30)20(33-24(27)31)14-16-6-2-1-3-7-16/h1-10,13-15H,11-12H2,(H,25,28)(H,26,29)/b20-14- |
| InChIKey | DTJRYPGWAVOSEW-ZHZULCJRSA-N |
| XLogP | 4.47 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|