C25H25N3O6S — CID 30533337
N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(2,2-dimethylpropanoylamino)benzamide (PubChem CID 30533337) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(2,2-dimethylpropanoylamino)benzamide.
| Compound Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(2,2-dimethylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 30533337 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(2,2-dimethylpropanoylamino)benzamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(C(=O)NCCN2C(=O)S/C(=C\c3ccc4c(c3)OCO4)C2=O)c1 |
| InChI | InChI=1S/C25H25N3O6S/c1-25(2,3)23(31)27-17-6-4-5-16(13-17)21(29)26-9-10-28-22(30)20(35-24(28)32)12-15-7-8-18-19(11-15)34-14-33-18/h4-8,11-13H,9-10,14H2,1-3H3,(H,26,29)(H,27,31)/b20-12- |
| InChIKey | VQEQHARBTULLJM-NDENLUEZSA-N |
| XLogP | 3.87 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|