C17H12Cl2N2O3S2 — CID 74292503
N-[2-[5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]thiophene-2-carboxamide (PubChem CID 74292503) has the molecular formula C17H12Cl2N2O3S2 and a molecular weight of 427.33 g/mol. Its IUPAC name is N-[2-[5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 74292503 |
| Molecular Formula | C17H12Cl2N2O3S2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 425.97 |
| IUPAC Name | N-[2-[5-[(2,4-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCN1C(=O)SC(=Cc2ccc(Cl)cc2Cl)C1=O)c1cccs1 |
| InChI | InChI=1S/C17H12Cl2N2O3S2/c18-11-4-3-10(12(19)9-11)8-14-16(23)21(17(24)26-14)6-5-20-15(22)13-2-1-7-25-13/h1-4,7-9H,5-6H2,(H,20,22) |
| InChIKey | RXKKYBHZPLDIGW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|