C24H15Cl2NO3S — CID 11754368
(5E)-5-[(2,4-dichlorophenyl)methylidene]-3-[2-oxo-2-(4-phenylphenyl)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 11754368) has the molecular formula C24H15Cl2NO3S and a molecular weight of 468.36 g/mol. Its IUPAC name is (5E)-5-[(2,4-dichlorophenyl)methylidene]-3-[2-oxo-2-(4-phenylphenyl)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2,4-dichlorophenyl)methylidene]-3-[2-oxo-2-(4-phenylphenyl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11754368 |
| Molecular Formula | C24H15Cl2NO3S |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.01 |
| IUPAC Name | (5E)-5-[(2,4-dichlorophenyl)methylidene]-3-[2-oxo-2-(4-phenylphenyl)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(Cl)cc2Cl)C1=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H15Cl2NO3S/c25-19-11-10-18(20(26)13-19)12-22-23(29)27(24(30)31-22)14-21(28)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-13H,14H2/b22-12+ |
| InChIKey | HWTUNBIUIJFKJK-WSDLNYQXSA-N |
| XLogP | 6.58 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|