C18H10Cl3NO3S — CID 126352001
(5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(2,3-dichlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126352001) has the molecular formula C18H10Cl3NO3S and a molecular weight of 426.71 g/mol. Its IUPAC name is (5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(2,3-dichlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(2,3-dichlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126352001 |
| Molecular Formula | C18H10Cl3NO3S |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 424.94 |
| IUPAC Name | (5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(2,3-dichlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cccc(Cl)c2Cl)C1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H10Cl3NO3S/c19-12-6-4-10(5-7-12)14(23)9-22-17(24)15(26-18(22)25)8-11-2-1-3-13(20)16(11)21/h1-8H,9H2/b15-8+ |
| InChIKey | MIOFNRLGDZSGRJ-OVCLIPMQSA-N |
| XLogP | 5.57 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|