C18H11ClFNO3S — CID 1333414
(5Z)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 1333414) has the molecular formula C18H11ClFNO3S and a molecular weight of 375.81 g/mol. Its IUPAC name is (5Z)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1333414 |
| Molecular Formula | C18H11ClFNO3S |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | (5Z)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(4-fluorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(F)cc2)C1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H11ClFNO3S/c19-13-5-3-12(4-6-13)15(22)10-21-17(23)16(25-18(21)24)9-11-1-7-14(20)8-2-11/h1-9H,10H2/b16-9- |
| InChIKey | OMXXNEOMLFXXMO-SXGWCWSVSA-N |
| XLogP | 4.40 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|