C25H16BrCl2NO4S — CID 126281253
(5E)-5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126281253) has the molecular formula C25H16BrCl2NO4S and a molecular weight of 577.28 g/mol. Its IUPAC name is (5E)-5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126281253 |
| Molecular Formula | C25H16BrCl2NO4S |
| Molecular Weight | 577.28 g/mol |
| Exact Mass | 574.94 |
| IUPAC Name | (5E)-5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cc(Br)ccc2OCc2ccccc2Cl)C1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H16BrCl2NO4S/c26-18-7-10-22(33-14-16-3-1-2-4-20(16)28)17(11-18)12-23-24(31)29(25(32)34-23)13-21(30)15-5-8-19(27)9-6-15/h1-12H,13-14H2/b23-12+ |
| InChIKey | YGEWOCMKNGJLDP-FSJBWODESA-N |
| XLogP | 7.25 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.28 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|