C19H13BrClNO4S — CID 126370460
(5E)-5-[(5-bromo-2-methoxyphenyl)methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126370460) has the molecular formula C19H13BrClNO4S and a molecular weight of 466.74 g/mol. Its IUPAC name is (5E)-5-[(5-bromo-2-methoxyphenyl)methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(5-bromo-2-methoxyphenyl)methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126370460 |
| Molecular Formula | C19H13BrClNO4S |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 464.94 |
| IUPAC Name | (5E)-5-[(5-bromo-2-methoxyphenyl)methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(Br)cc1/C=C1/SC(=O)N(CC(=O)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C19H13BrClNO4S/c1-26-16-7-4-13(20)8-12(16)9-17-18(24)22(19(25)27-17)10-15(23)11-2-5-14(21)6-3-11/h2-9H,10H2,1H3/b17-9+ |
| InChIKey | ODIIIJBGKSOMNH-RQZCQDPDSA-N |
| XLogP | 5.03 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|