C17H19BrN2O4S — CID 126223429
2-[(5Z)-5-[(5-bromo-2-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-butylacetamide (PubChem CID 126223429) has the molecular formula C17H19BrN2O4S and a molecular weight of 427.32 g/mol. Its IUPAC name is 2-[(5Z)-5-[(5-bromo-2-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-butylacetamide.
| Compound Name | 2-[(5Z)-5-[(5-bromo-2-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-butylacetamide |
|---|---|
| PubChem CID | 126223429 |
| Molecular Formula | C17H19BrN2O4S |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 2-[(5Z)-5-[(5-bromo-2-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-butylacetamide |
| SMILES | CCCCNC(=O)CN1C(=O)S/C(=C\c2cc(Br)ccc2OC)C1=O |
| InChI | InChI=1S/C17H19BrN2O4S/c1-3-4-7-19-15(21)10-20-16(22)14(25-17(20)23)9-11-8-12(18)5-6-13(11)24-2/h5-6,8-9H,3-4,7,10H2,1-2H3,(H,19,21)/b14-9- |
| InChIKey | ODZGMWQYMKLHRI-ZROIWOOFSA-N |
| XLogP | 3.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|